C19H19BrFN5 — CID 169275311
8-bromo-N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]quinazolin-2-amine (PubChem CID 169275311) has the molecular formula C19H19BrFN5 and a molecular weight of 416.30 g/mol. Its IUPAC name is 8-bromo-N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]quinazolin-2-amine.
| Compound Name | 8-bromo-N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 169275311 |
| Molecular Formula | C19H19BrFN5 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 8-bromo-N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]quinazolin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4cccc(Br)c4n3)cc2F)CC1 |
| InChI | InChI=1S/C19H19BrFN5/c1-25-7-9-26(10-8-25)17-6-5-14(11-16(17)21)23-19-22-12-13-3-2-4-15(20)18(13)24-19/h2-6,11-12H,7-10H2,1H3,(H,22,23,24) |
| InChIKey | CULJTSHTBRMDGN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|