About 2-fluoro-3H-1,2,3-benzothiadiazole
2-fluoro-3H-1,2,3-benzothiadiazole (PubChem CID 169275473) has the molecular formula C6H5FN2S
and a molecular weight of 156.19 g/mol. Its IUPAC name is 2-fluoro-3H-1,2,3-benzothiadiazole.
Molecular Properties
| Compound Name | 2-fluoro-3H-1,2,3-benzothiadiazole |
| PubChem CID | 169275473 |
| Molecular Formula | C6H5FN2S |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.02 |
| IUPAC Name | 2-fluoro-3H-1,2,3-benzothiadiazole |
| SMILES | FN1Nc2ccccc2S1 |
| InChI | InChI=1S/C6H5FN2S/c7-9-8-5-3-1-2-4-6(5)10-9/h1-4,8H |
| InChIKey | HBVUHWRBCBXGPB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3H-1,2,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3H-1,2,3-benzothiadiazole?
The IUPAC name of 2-fluoro-3H-1,2,3-benzothiadiazole (CID 169275473) is 2-fluoro-3H-1,2,3-benzothiadiazole.
What is the SMILES notation for 2-fluoro-3H-1,2,3-benzothiadiazole?
The canonical SMILES for 2-fluoro-3H-1,2,3-benzothiadiazole is FN1Nc2ccccc2S1.
What is the InChIKey of 2-fluoro-3H-1,2,3-benzothiadiazole?
The InChIKey is HBVUHWRBCBXGPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FN2S/c7-9-8-5-3-1-2-4-6(5)10-9/h1-4,8H.
What are the key properties of 2-fluoro-3H-1,2,3-benzothiadiazole?
2-fluoro-3H-1,2,3-benzothiadiazole has a molecular weight of 156.19 g/mol, XLogP of 2.22, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3H-1,2,3-benzothiadiazole is sourced from PubChem (CID 169275473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).