C18H12Cl4O4 — CID 169275591
7-(4-chlorophenyl)-8-(2,2,2-trichloroacetyl)spiro[4.5]dec-7-ene-6,9,10-trione (PubChem CID 169275591) has the molecular formula C18H12Cl4O4 and a molecular weight of 434.10 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-8-(2,2,2-trichloroacetyl)spiro[4.5]dec-7-ene-6,9,10-trione.
| Compound Name | 7-(4-chlorophenyl)-8-(2,2,2-trichloroacetyl)spiro[4.5]dec-7-ene-6,9,10-trione |
|---|---|
| PubChem CID | 169275591 |
| Molecular Formula | C18H12Cl4O4 |
| Molecular Weight | 434.10 g/mol |
| Exact Mass | 431.95 |
| IUPAC Name | 7-(4-chlorophenyl)-8-(2,2,2-trichloroacetyl)spiro[4.5]dec-7-ene-6,9,10-trione |
| SMILES | O=C1C(=O)C2(CCCC2)C(=O)C(c2ccc(Cl)cc2)=C1C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H12Cl4O4/c19-10-5-3-9(4-6-10)11-12(15(25)18(20,21)22)13(23)16(26)17(14(11)24)7-1-2-8-17/h3-6H,1-2,7-8H2 |
| InChIKey | ZOSDRGMYMQNLLR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.10 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|