C50H31N5O — CID 169276097
9-[7-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]pyrido[2,3-b]indole (PubChem CID 169276097) has the molecular formula C50H31N5O and a molecular weight of 717.83 g/mol. Its IUPAC name is 9-[7-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]pyrido[2,3-b]indole.
| Compound Name | 9-[7-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 169276097 |
| Molecular Formula | C50H31N5O |
| Molecular Weight | 717.83 g/mol |
| Exact Mass | 717.25 |
| IUPAC Name | 9-[7-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]pyrido[2,3-b]indole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc5c(c4)oc4cc(-n6c7ccccc7c7cccnc76)ccc45)n3)cc2)cc1 |
| InChI | InChI=1S/C50H31N5O/c1-3-10-32(11-4-1)34-17-21-36(22-18-34)47-52-48(37-23-19-35(20-24-37)33-12-5-2-6-13-33)54-49(53-47)38-25-27-41-42-28-26-39(31-46(42)56-45(41)30-38)55-44-16-8-7-14-40(44)43-15-9-29-51-50(43)55/h1-31H |
| InChIKey | BAUQCSLYECNSST-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.83 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |