About N-[(E)-1-(4-bromo-2,6-difluorophenyl)ethylideneamino]-4-methylaniline
N-[(E)-1-(4-bromo-2,6-difluorophenyl)ethylideneamino]-4-methylaniline (PubChem CID 169277635) has the molecular formula C15H13BrF2N2
and a molecular weight of 339.18 g/mol. Its IUPAC name is N-[(E)-1-(4-bromo-2,6-difluorophenyl)ethylideneamino]-4-methylaniline.
Molecular Properties
| Compound Name | N-[(E)-1-(4-bromo-2,6-difluorophenyl)ethylideneamino]-4-methylaniline |
| PubChem CID | 169277635 |
| Molecular Formula | C15H13BrF2N2 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | N-[(E)-1-(4-bromo-2,6-difluorophenyl)ethylideneamino]-4-methylaniline |
| SMILES | C/C(=N\Nc1ccc(C)cc1)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C15H13BrF2N2/c1-9-3-5-12(6-4-9)20-19-10(2)15-13(17)7-11(16)8-14(15)18/h3-8,20H,1-2H3/b19-10+ |
| InChIKey | UWQCDCXZYUDJIE-VXLYETTFSA-N |
| XLogP | 4.87 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-1-(4-bromo-2,6-difluorophenyl)ethylideneamino]-4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1-(4-bromo-2,6-difluorophenyl)ethylideneamino]-4-methylaniline?
The IUPAC name of N-[(E)-1-(4-bromo-2,6-difluorophenyl)ethylideneamino]-4-methylaniline (CID 169277635) is N-[(E)-1-(4-bromo-2,6-difluorophenyl)ethylideneamino]-4-methylaniline.
What is the SMILES notation for N-[(E)-1-(4-bromo-2,6-difluorophenyl)ethylideneamino]-4-methylaniline?
The canonical SMILES for N-[(E)-1-(4-bromo-2,6-difluorophenyl)ethylideneamino]-4-methylaniline is C/C(=N\Nc1ccc(C)cc1)c1c(F)cc(Br)cc1F.
What is the InChIKey of N-[(E)-1-(4-bromo-2,6-difluorophenyl)ethylideneamino]-4-methylaniline?
The InChIKey is UWQCDCXZYUDJIE-VXLYETTFSA-N. The full InChI is InChI=1S/C15H13BrF2N2/c1-9-3-5-12(6-4-9)20-19-10(2)15-13(17)7-11(16)8-14(15)18/h3-8,20H,1-2H3/b19-10+.
What are the key properties of N-[(E)-1-(4-bromo-2,6-difluorophenyl)ethylideneamino]-4-methylaniline?
N-[(E)-1-(4-bromo-2,6-difluorophenyl)ethylideneamino]-4-methylaniline has a molecular weight of 339.18 g/mol, XLogP of 4.87, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1-(4-bromo-2,6-difluorophenyl)ethylideneamino]-4-methylaniline is sourced from PubChem (CID 169277635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).