C22H15F15 — CID 169277761
2-methyl-5-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)-2,6-bis(trifluoromethyl)phenyl]-1,3-bis(trifluoromethyl)benzene (PubChem CID 169277761) has the molecular formula C22H15F15 and a molecular weight of 564.33 g/mol. Its IUPAC name is 2-methyl-5-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)-2,6-bis(trifluoromethyl)phenyl]-1,3-bis(trifluoromethyl)benzene.
| Compound Name | 2-methyl-5-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)-2,6-bis(trifluoromethyl)phenyl]-1,3-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 169277761 |
| Molecular Formula | C22H15F15 |
| Molecular Weight | 564.33 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | 2-methyl-5-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)-2,6-bis(trifluoromethyl)phenyl]-1,3-bis(trifluoromethyl)benzene |
| SMILES | Cc1c(C(F)(F)F)cc(-c2c(C(F)(F)F)cc(CC(C)(C)C(F)(F)F)cc2C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C22H15F15/c1-9-12(18(23,24)25)6-11(7-13(9)19(26,27)28)16-14(20(29,30)31)4-10(5-15(16)21(32,33)34)8-17(2,3)22(35,36)37/h4-7H,8H2,1-3H3 |
| InChIKey | PYORPKQKAGKOKA-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.33 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |