C22H24F3N7O — CID 169277820
1-methyl-4-[[5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexan-1-ol (PubChem CID 169277820) has the molecular formula C22H24F3N7O and a molecular weight of 459.48 g/mol. Its IUPAC name is 1-methyl-4-[[5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 1-methyl-4-[[5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 169277820 |
| Molecular Formula | C22H24F3N7O |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 1-methyl-4-[[5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexan-1-ol |
| SMILES | Cc1nc2ccc(-c3ccn4nc(NC5CCC(C)(O)CC5)ncc34)nc2n1CC(F)(F)F |
| InChI | InChI=1S/C22H24F3N7O/c1-13-27-17-4-3-16(29-19(17)31(13)12-22(23,24)25)15-7-10-32-18(15)11-26-20(30-32)28-14-5-8-21(2,33)9-6-14/h3-4,7,10-11,14,33H,5-6,8-9,12H2,1-2H3,(H,28,30) |
| InChIKey | VOCYUKYGGQNWIM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |