C22H25F2N9O — CID 169277831
3-[[5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyrazin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-N,N,1-trimethylcyclobutane-1-carboxamide (PubChem CID 169277831) has the molecular formula C22H25F2N9O and a molecular weight of 469.50 g/mol. Its IUPAC name is 3-[[5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyrazin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-N,N,1-trimethylcyclobutane-1-carboxamide.
| Compound Name | 3-[[5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyrazin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-N,N,1-trimethylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 169277831 |
| Molecular Formula | C22H25F2N9O |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 3-[[5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyrazin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-N,N,1-trimethylcyclobutane-1-carboxamide |
| SMILES | Cc1nc2ncc(-c3ccn4nc(NC5CC(C)(C(=O)N(C)C)C5)ncc34)nc2n1CC(F)F |
| InChI | InChI=1S/C22H25F2N9O/c1-12-27-18-19(32(12)11-17(23)24)29-15(9-25-18)14-5-6-33-16(14)10-26-21(30-33)28-13-7-22(2,8-13)20(34)31(3)4/h5-6,9-10,13,17H,7-8,11H2,1-4H3,(H,28,30) |
| InChIKey | IWHXHJHQCVIWEY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 106.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |