C22H25F2N7O — CID 169277853
4-[[5-[1-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-6-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol (PubChem CID 169277853) has the molecular formula C22H25F2N7O and a molecular weight of 441.49 g/mol. Its IUPAC name is 4-[[5-[1-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-6-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[5-[1-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-6-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 169277853 |
| Molecular Formula | C22H25F2N7O |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 4-[[5-[1-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-6-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
| SMILES | Cc1nc2ncc(-c3ccn4nc(NC5CCC(C)(O)CC5)ncc34)cc2n1CC(F)F |
| InChI | InChI=1S/C22H25F2N7O/c1-13-27-20-17(30(13)12-19(23)24)9-14(10-25-20)16-5-8-31-18(16)11-26-21(29-31)28-15-3-6-22(2,32)7-4-15/h5,8-11,15,19,32H,3-4,6-7,12H2,1-2H3,(H,28,29) |
| InChIKey | HGRJWABREHAMPT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |