C21H26N2O3S — CID 169277909
(4-methylsulfonylpiperazin-1-yl)-[4-(3-propan-2-ylphenyl)phenyl]methanone (PubChem CID 169277909) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is (4-methylsulfonylpiperazin-1-yl)-[4-(3-propan-2-ylphenyl)phenyl]methanone.
| Compound Name | (4-methylsulfonylpiperazin-1-yl)-[4-(3-propan-2-ylphenyl)phenyl]methanone |
|---|---|
| PubChem CID | 169277909 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (4-methylsulfonylpiperazin-1-yl)-[4-(3-propan-2-ylphenyl)phenyl]methanone |
| SMILES | CC(C)c1cccc(-c2ccc(C(=O)N3CCN(S(C)(=O)=O)CC3)cc2)c1 |
| InChI | InChI=1S/C21H26N2O3S/c1-16(2)19-5-4-6-20(15-19)17-7-9-18(10-8-17)21(24)22-11-13-23(14-12-22)27(3,25)26/h4-10,15-16H,11-14H2,1-3H3 |
| InChIKey | HNGIRZUKQWGPKJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |