C20H6Br4ClO4- — CID 169278542
2-(2,4,5,7-tetrabromo-3-chloro-6-oxoxanthen-9-yl)benzoate (PubChem CID 169278542) has the molecular formula C20H6Br4ClO4- and a molecular weight of 665.33 g/mol. Its IUPAC name is 2-(2,4,5,7-tetrabromo-3-chloro-6-oxoxanthen-9-yl)benzoate.
| Compound Name | 2-(2,4,5,7-tetrabromo-3-chloro-6-oxoxanthen-9-yl)benzoate |
|---|---|
| PubChem CID | 169278542 |
| Molecular Formula | C20H6Br4ClO4- |
| Molecular Weight | 665.33 g/mol |
| Exact Mass | 660.67 |
| IUPAC Name | 2-(2,4,5,7-tetrabromo-3-chloro-6-oxoxanthen-9-yl)benzoate |
| SMILES | O=C([O-])c1ccccc1-c1c2cc(Br)c(=O)c(Br)c-2oc2c(Br)c(Cl)c(Br)cc12 |
| InChI | InChI=1S/C20H7Br4ClO4/c21-11-5-9-13(7-3-1-2-4-8(7)20(27)28)10-6-12(22)17(26)15(24)19(10)29-18(9)14(23)16(11)25/h1-6H,(H,27,28)/p-1 |
| InChIKey | UDEHDDWJFBFNCQ-UHFFFAOYSA-M |
| XLogP | 6.63 |
| TPSA | 70.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.33 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|