C18H15F2N3O2 — CID 169279197
N-[1-(6,7-difluoro-4-oxo-3H-phthalazin-1-yl)ethyl]-N-methylbenzamide (PubChem CID 169279197) has the molecular formula C18H15F2N3O2 and a molecular weight of 343.33 g/mol. Its IUPAC name is N-[1-(6,7-difluoro-4-oxo-3H-phthalazin-1-yl)ethyl]-N-methylbenzamide.
| Compound Name | N-[1-(6,7-difluoro-4-oxo-3H-phthalazin-1-yl)ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 169279197 |
| Molecular Formula | C18H15F2N3O2 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[1-(6,7-difluoro-4-oxo-3H-phthalazin-1-yl)ethyl]-N-methylbenzamide |
| SMILES | CC(c1n[nH]c(=O)c2cc(F)c(F)cc12)N(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H15F2N3O2/c1-10(23(2)18(25)11-6-4-3-5-7-11)16-12-8-14(19)15(20)9-13(12)17(24)22-21-16/h3-10H,1-2H3,(H,22,24) |
| InChIKey | VVHOZFSMJLINSD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |