About 7-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1H-indazole
7-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1H-indazole (PubChem CID 169281050) has the molecular formula C11H12N4
and a molecular weight of 200.25 g/mol. Its IUPAC name is 7-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1H-indazole.
Molecular Properties
| Compound Name | 7-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1H-indazole |
| PubChem CID | 169281050 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 7-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1H-indazole |
| SMILES | c1cc(CC2=NCCN2)c2[nH]ncc2c1 |
| InChI | InChI=1S/C11H12N4/c1-2-8(6-10-12-4-5-13-10)11-9(3-1)7-14-15-11/h1-3,7H,4-6H2,(H,12,13)(H,14,15) |
| InChIKey | BWKFEDDIPLAPMX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1H-indazole?
The IUPAC name of 7-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1H-indazole (CID 169281050) is 7-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1H-indazole.
What is the SMILES notation for 7-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1H-indazole?
The canonical SMILES for 7-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1H-indazole is c1cc(CC2=NCCN2)c2[nH]ncc2c1.
What is the InChIKey of 7-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1H-indazole?
The InChIKey is BWKFEDDIPLAPMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4/c1-2-8(6-10-12-4-5-13-10)11-9(3-1)7-14-15-11/h1-3,7H,4-6H2,(H,12,13)(H,14,15).
What are the key properties of 7-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1H-indazole?
7-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1H-indazole has a molecular weight of 200.25 g/mol, XLogP of 1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1H-indazole is sourced from PubChem (CID 169281050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).