About 5-[2-chloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)phenyl]-1H-pyrazole
5-[2-chloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)phenyl]-1H-pyrazole (PubChem CID 169281075) has the molecular formula C13H13ClN4
and a molecular weight of 260.73 g/mol. Its IUPAC name is 5-[2-chloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)phenyl]-1H-pyrazole.
Molecular Properties
| Compound Name | 5-[2-chloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)phenyl]-1H-pyrazole |
| PubChem CID | 169281075 |
| Molecular Formula | C13H13ClN4 |
| Molecular Weight | 260.73 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 5-[2-chloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)phenyl]-1H-pyrazole |
| SMILES | Clc1cc(CC2=NCCN2)ccc1-c1ccn[nH]1 |
| InChI | InChI=1S/C13H13ClN4/c14-11-7-9(8-13-15-5-6-16-13)1-2-10(11)12-3-4-17-18-12/h1-4,7H,5-6,8H2,(H,15,16)(H,17,18) |
| InChIKey | BENSVNOVDUFDQG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.73 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2-chloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)phenyl]-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-chloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)phenyl]-1H-pyrazole?
The IUPAC name of 5-[2-chloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)phenyl]-1H-pyrazole (CID 169281075) is 5-[2-chloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)phenyl]-1H-pyrazole.
What is the SMILES notation for 5-[2-chloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)phenyl]-1H-pyrazole?
The canonical SMILES for 5-[2-chloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)phenyl]-1H-pyrazole is Clc1cc(CC2=NCCN2)ccc1-c1ccn[nH]1.
What is the InChIKey of 5-[2-chloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)phenyl]-1H-pyrazole?
The InChIKey is BENSVNOVDUFDQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN4/c14-11-7-9(8-13-15-5-6-16-13)1-2-10(11)12-3-4-17-18-12/h1-4,7H,5-6,8H2,(H,15,16)(H,17,18).
What are the key properties of 5-[2-chloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)phenyl]-1H-pyrazole?
5-[2-chloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)phenyl]-1H-pyrazole has a molecular weight of 260.73 g/mol, XLogP of 2.27, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-chloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)phenyl]-1H-pyrazole is sourced from PubChem (CID 169281075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).