C19H23N3O — CID 169281625
7-ethoxy-3-N,3-N,9-N,9-N-tetramethylacridine-3,9-diamine (PubChem CID 169281625) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is 7-ethoxy-3-N,3-N,9-N,9-N-tetramethylacridine-3,9-diamine.
| Compound Name | 7-ethoxy-3-N,3-N,9-N,9-N-tetramethylacridine-3,9-diamine |
|---|---|
| PubChem CID | 169281625 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 7-ethoxy-3-N,3-N,9-N,9-N-tetramethylacridine-3,9-diamine |
| SMILES | CCOc1ccc2nc3cc(N(C)C)ccc3c(N(C)C)c2c1 |
| InChI | InChI=1S/C19H23N3O/c1-6-23-14-8-10-17-16(12-14)19(22(4)5)15-9-7-13(21(2)3)11-18(15)20-17/h7-12H,6H2,1-5H3 |
| InChIKey | BRHLHCKUJVYMAB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|