C16H18N2O3 — CID 16928325
methyl N-[2-(4-methoxyphenyl)-2-pyridin-2-ylethyl]carbamate (PubChem CID 16928325) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is methyl N-[2-(4-methoxyphenyl)-2-pyridin-2-ylethyl]carbamate.
| Compound Name | methyl N-[2-(4-methoxyphenyl)-2-pyridin-2-ylethyl]carbamate |
|---|---|
| PubChem CID | 16928325 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | methyl N-[2-(4-methoxyphenyl)-2-pyridin-2-ylethyl]carbamate |
| SMILES | COC(=O)NCC(c1ccc(OC)cc1)c1ccccn1 |
| InChI | InChI=1S/C16H18N2O3/c1-20-13-8-6-12(7-9-13)14(11-18-16(19)21-2)15-5-3-4-10-17-15/h3-10,14H,11H2,1-2H3,(H,18,19) |
| InChIKey | QTCFTZDMVSUHQE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |