C30H60O6 — CID 169283744
2,2-dimethyl-4,5,6,7,8-pentakis[(2-methylpropan-2-yl)oxy]octan-3-one (PubChem CID 169283744) has the molecular formula C30H60O6 and a molecular weight of 516.80 g/mol. Its IUPAC name is 2,2-dimethyl-4,5,6,7,8-pentakis[(2-methylpropan-2-yl)oxy]octan-3-one.
| Compound Name | 2,2-dimethyl-4,5,6,7,8-pentakis[(2-methylpropan-2-yl)oxy]octan-3-one |
|---|---|
| PubChem CID | 169283744 |
| Molecular Formula | C30H60O6 |
| Molecular Weight | 516.80 g/mol |
| Exact Mass | 516.44 |
| IUPAC Name | 2,2-dimethyl-4,5,6,7,8-pentakis[(2-methylpropan-2-yl)oxy]octan-3-one |
| SMILES | CC(C)(C)OCC(OC(C)(C)C)C(OC(C)(C)C)C(OC(C)(C)C)C(OC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C30H60O6/c1-25(2,3)24(31)23(36-30(16,17)18)22(35-29(13,14)15)21(34-28(10,11)12)20(33-27(7,8)9)19-32-26(4,5)6/h20-23H,19H2,1-18H3 |
| InChIKey | QFQMWRZQSUVXDZ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.80 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |