C30H58O6 — CID 169283748
2,2,9,9-tetramethyl-4,5,6,7-tetrakis[(2-methylpropan-2-yl)oxy]decane-3,8-dione (PubChem CID 169283748) has the molecular formula C30H58O6 and a molecular weight of 514.79 g/mol. Its IUPAC name is 2,2,9,9-tetramethyl-4,5,6,7-tetrakis[(2-methylpropan-2-yl)oxy]decane-3,8-dione.
| Compound Name | 2,2,9,9-tetramethyl-4,5,6,7-tetrakis[(2-methylpropan-2-yl)oxy]decane-3,8-dione |
|---|---|
| PubChem CID | 169283748 |
| Molecular Formula | C30H58O6 |
| Molecular Weight | 514.79 g/mol |
| Exact Mass | 514.42 |
| IUPAC Name | 2,2,9,9-tetramethyl-4,5,6,7-tetrakis[(2-methylpropan-2-yl)oxy]decane-3,8-dione |
| SMILES | CC(C)(C)OC(C(=O)C(C)(C)C)C(OC(C)(C)C)C(OC(C)(C)C)C(OC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C30H58O6/c1-25(2,3)23(31)21(35-29(13,14)15)19(33-27(7,8)9)20(34-28(10,11)12)22(36-30(16,17)18)24(32)26(4,5)6/h19-22H,1-18H3 |
| InChIKey | DVFCJURSJQXLSN-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.79 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |