C18H25NO3 — CID 169283803
(2S)-2-(1-bicyclo[2.2.2]octanyl)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]acetic acid (PubChem CID 169283803) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (2S)-2-(1-bicyclo[2.2.2]octanyl)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]acetic acid.
| Compound Name | (2S)-2-(1-bicyclo[2.2.2]octanyl)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]acetic acid |
|---|---|
| PubChem CID | 169283803 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (2S)-2-(1-bicyclo[2.2.2]octanyl)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]acetic acid |
| SMILES | O=C(O)[C@@H](N[C@@H](CO)c1ccccc1)C12CCC(CC1)CC2 |
| InChI | InChI=1S/C18H25NO3/c20-12-15(14-4-2-1-3-5-14)19-16(17(21)22)18-9-6-13(7-10-18)8-11-18/h1-5,13,15-16,19-20H,6-12H2,(H,21,22)/t13?,15-,16+,18?/m0/s1 |
| InChIKey | FYQFWZUJWCPOGH-ZWEVUMDMSA-N |
| XLogP | 2.73 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |