C60H53N — CID 169284425
10-benzhydrylidene-N-(4-tert-butyl-2-phenylphenyl)-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylanthracen-2-amine (PubChem CID 169284425) has the molecular formula C60H53N and a molecular weight of 788.09 g/mol. Its IUPAC name is 10-benzhydrylidene-N-(4-tert-butyl-2-phenylphenyl)-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylanthracen-2-amine.
| Compound Name | 10-benzhydrylidene-N-(4-tert-butyl-2-phenylphenyl)-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylanthracen-2-amine |
|---|---|
| PubChem CID | 169284425 |
| Molecular Formula | C60H53N |
| Molecular Weight | 788.09 g/mol |
| Exact Mass | 787.42 |
| IUPAC Name | 10-benzhydrylidene-N-(4-tert-butyl-2-phenylphenyl)-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylanthracen-2-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc3c(c2)C(C)(C)c2ccccc2C3=C(c2ccccc2)c2ccccc2)c2ccc3c(c2)C(C)(C)c2ccccc2-3)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C60H53N/c1-58(2,3)43-31-36-55(50(37-43)40-21-11-8-12-22-40)61(44-32-34-47-46-27-17-19-29-51(46)59(4,5)53(47)38-44)45-33-35-49-54(39-45)60(6,7)52-30-20-18-28-48(52)57(49)56(41-23-13-9-14-24-41)42-25-15-10-16-26-42/h8-39H,1-7H3 |
| InChIKey | UATFPMOVSAMLTD-UHFFFAOYSA-N |
| XLogP | 16.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.09 |
| LogP ≤ 5 | 16.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|