C18H30O4 — CID 169285678
1,2-bis[2-[(2-methylpropan-2-yl)oxy]ethoxy]benzene (PubChem CID 169285678) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is 1,2-bis[2-[(2-methylpropan-2-yl)oxy]ethoxy]benzene.
| Compound Name | 1,2-bis[2-[(2-methylpropan-2-yl)oxy]ethoxy]benzene |
|---|---|
| PubChem CID | 169285678 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 1,2-bis[2-[(2-methylpropan-2-yl)oxy]ethoxy]benzene |
| SMILES | CC(C)(C)OCCOc1ccccc1OCCOC(C)(C)C |
| InChI | InChI=1S/C18H30O4/c1-17(2,3)21-13-11-19-15-9-7-8-10-16(15)20-12-14-22-18(4,5)6/h7-10H,11-14H2,1-6H3 |
| InChIKey | MIPWPFXVGCABOE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|