C27H24N10S3Zn+2 — CID 169285978
zinc N-(4-pyridin-2-yl-1,3-thiazol-2-yl)-N',N'-bis[[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]methyl]methanediamine (PubChem CID 169285978) has the molecular formula C27H24N10S3Zn+2 and a molecular weight of 650.15 g/mol. Its IUPAC name is zinc N-(4-pyridin-2-yl-1,3-thiazol-2-yl)-N',N'-bis[[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]methyl]methanediamine.
| Compound Name | zinc N-(4-pyridin-2-yl-1,3-thiazol-2-yl)-N',N'-bis[[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]methyl]methanediamine |
|---|---|
| PubChem CID | 169285978 |
| Molecular Formula | C27H24N10S3Zn+2 |
| Molecular Weight | 650.15 g/mol |
| Exact Mass | 648.06 |
| IUPAC Name | zinc N-(4-pyridin-2-yl-1,3-thiazol-2-yl)-N',N'-bis[[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]methyl]methanediamine |
| SMILES | [Zn+2].c1ccc(-c2csc(NCN(CNc3nc(-c4ccccn4)cs3)CNc3nc(-c4ccccn4)cs3)n2)nc1 |
| InChI | InChI=1S/C27H24N10S3.Zn/c1-4-10-28-19(7-1)22-13-38-25(34-22)31-16-37(17-32-26-35-23(14-39-26)20-8-2-5-11-29-20)18-33-27-36-24(15-40-27)21-9-3-6-12-30-21;/h1-15H,16-18H2,(H,31,34)(H,32,35)(H,33,36);/q;+2 |
| InChIKey | VHLAQDZDDGJTQA-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.15 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|