About 4-iodo-N,N-bis(phosphanyl)aniline
4-iodo-N,N-bis(phosphanyl)aniline (PubChem CID 169286192) has the molecular formula C6H8INP2
and a molecular weight of 282.99 g/mol. Its IUPAC name is 4-iodo-N,N-bis(phosphanyl)aniline.
Molecular Properties
| Compound Name | 4-iodo-N,N-bis(phosphanyl)aniline |
| PubChem CID | 169286192 |
| Molecular Formula | C6H8INP2 |
| Molecular Weight | 282.99 g/mol |
| Exact Mass | 282.92 |
| IUPAC Name | 4-iodo-N,N-bis(phosphanyl)aniline |
| SMILES | PN(P)c1ccc(I)cc1 |
| InChI | InChI=1S/C6H8INP2/c7-5-1-3-6(4-2-5)8(9)10/h1-4H,9-10H2 |
| InChIKey | XQTYYJDSWQVFQD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.99 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-N,N-bis(phosphanyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-N,N-bis(phosphanyl)aniline?
The IUPAC name of 4-iodo-N,N-bis(phosphanyl)aniline (CID 169286192) is 4-iodo-N,N-bis(phosphanyl)aniline.
What is the SMILES notation for 4-iodo-N,N-bis(phosphanyl)aniline?
The canonical SMILES for 4-iodo-N,N-bis(phosphanyl)aniline is PN(P)c1ccc(I)cc1.
What is the InChIKey of 4-iodo-N,N-bis(phosphanyl)aniline?
The InChIKey is XQTYYJDSWQVFQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8INP2/c7-5-1-3-6(4-2-5)8(9)10/h1-4H,9-10H2.
What are the key properties of 4-iodo-N,N-bis(phosphanyl)aniline?
4-iodo-N,N-bis(phosphanyl)aniline has a molecular weight of 282.99 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-N,N-bis(phosphanyl)aniline is sourced from PubChem (CID 169286192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).