About CID 169286240
CID 169286240 (PubChem CID 169286240) has the molecular formula C5H13BO8P2Y
and a molecular weight of 362.82 g/mol.
Molecular Properties
| Compound Name | CID 169286240 |
| PubChem CID | 169286240 |
| Molecular Formula | C5H13BO8P2Y |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.92 |
| IUPAC Name | — |
| SMILES | O=[PH](O)O.[B][C@H]1C[C@@H](O)[C@@H](CO[PH](=O)O)O1.[Y] |
| InChI | InChI=1S/C5H10BO5P.H3O3P.Y/c6-5-1-3(7)4(11-5)2-10-12(8)9;1-4(2)3;/h3-5,7,12H,1-2H2,(H,8,9);4H,(H2,1,2,3);/t3-,4-,5-;;/m1../s1 |
| InChIKey | VOCBLLHBSFZYPK-PWWGHLKFSA-N |
| XLogP | -1.61 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 169286240 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169286240?
The IUPAC name of CID 169286240 (CID 169286240) is not available.
What is the SMILES notation for CID 169286240?
The canonical SMILES for CID 169286240 is O=[PH](O)O.[B][C@H]1C[C@@H](O)[C@@H](CO[PH](=O)O)O1.[Y].
What is the InChIKey of CID 169286240?
The InChIKey is VOCBLLHBSFZYPK-PWWGHLKFSA-N. The full InChI is InChI=1S/C5H10BO5P.H3O3P.Y/c6-5-1-3(7)4(11-5)2-10-12(8)9;1-4(2)3;/h3-5,7,12H,1-2H2,(H,8,9);4H,(H2,1,2,3);/t3-,4-,5-;;/m1../s1.
What are the key properties of CID 169286240?
CID 169286240 has a molecular weight of 362.82 g/mol, XLogP of -1.61, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169286240 is sourced from PubChem (CID 169286240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).