C80H57F2NO2Si — CID 169286364
N,N-bis[9-[4-(4-ethenylphenoxy)phenyl]-9-(4-fluorophenyl)fluoren-2-yl]-5,5-dimethylbenzo[b][1]benzosilol-3-amine (PubChem CID 169286364) has the molecular formula C80H57F2NO2Si and a molecular weight of 1130.42 g/mol. Its IUPAC name is N,N-bis[9-[4-(4-ethenylphenoxy)phenyl]-9-(4-fluorophenyl)fluoren-2-yl]-5,5-dimethylbenzo[b][1]benzosilol-3-amine.
| Compound Name | N,N-bis[9-[4-(4-ethenylphenoxy)phenyl]-9-(4-fluorophenyl)fluoren-2-yl]-5,5-dimethylbenzo[b][1]benzosilol-3-amine |
|---|---|
| PubChem CID | 169286364 |
| Molecular Formula | C80H57F2NO2Si |
| Molecular Weight | 1130.42 g/mol |
| Exact Mass | 1129.41 |
| IUPAC Name | N,N-bis[9-[4-(4-ethenylphenoxy)phenyl]-9-(4-fluorophenyl)fluoren-2-yl]-5,5-dimethylbenzo[b][1]benzosilol-3-amine |
| SMILES | C=Cc1ccc(Oc2ccc(C3(c4ccc(F)cc4)c4ccccc4-c4ccc(N(c5ccc6c(c5)C(c5ccc(F)cc5)(c5ccc(Oc7ccc(C=C)cc7)cc5)c5ccccc5-6)c5ccc6c(c5)[Si](C)(C)c5ccccc5-6)cc43)cc2)cc1 |
| InChI | InChI=1S/C80H57F2NO2Si/c1-5-52-19-38-63(39-20-52)84-65-42-27-56(28-43-65)79(54-23-31-58(81)32-24-54)73-16-10-7-13-67(73)69-46-35-60(49-75(69)79)83(62-37-48-72-71-15-9-12-18-77(71)86(3,4)78(72)51-62)61-36-47-70-68-14-8-11-17-74(68)80(76(70)50-61,55-25-33-59(82)34-26-55)57-29-44-66(45-30-57)85-64-40-21-53(6-2)22-41-64/h5-51H,1-2H2,3-4H3 |
| InChIKey | ZWDBQKUKXNTQTC-UHFFFAOYSA-N |
| XLogP | 19.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1130.42 |
| LogP ≤ 5 | 19.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|