C78H45F8NO3 — CID 169286422
N,N-bis[9-[4-(4-ethenylphenoxy)phenyl]-9-(2,3,5,6-tetrafluorophenyl)fluoren-2-yl]dibenzofuran-3-amine (PubChem CID 169286422) has the molecular formula C78H45F8NO3 and a molecular weight of 1196.21 g/mol. Its IUPAC name is N,N-bis[9-[4-(4-ethenylphenoxy)phenyl]-9-(2,3,5,6-tetrafluorophenyl)fluoren-2-yl]dibenzofuran-3-amine.
| Compound Name | N,N-bis[9-[4-(4-ethenylphenoxy)phenyl]-9-(2,3,5,6-tetrafluorophenyl)fluoren-2-yl]dibenzofuran-3-amine |
|---|---|
| PubChem CID | 169286422 |
| Molecular Formula | C78H45F8NO3 |
| Molecular Weight | 1196.21 g/mol |
| Exact Mass | 1195.33 |
| IUPAC Name | N,N-bis[9-[4-(4-ethenylphenoxy)phenyl]-9-(2,3,5,6-tetrafluorophenyl)fluoren-2-yl]dibenzofuran-3-amine |
| SMILES | C=Cc1ccc(Oc2ccc(C3(c4c(F)c(F)cc(F)c4F)c4ccccc4-c4ccc(N(c5ccc6c(c5)C(c5ccc(Oc7ccc(C=C)cc7)cc5)(c5c(F)c(F)cc(F)c5F)c5ccccc5-6)c5ccc6c(c5)oc5ccccc56)cc43)cc2)cc1 |
| InChI | InChI=1S/C78H45F8NO3/c1-3-44-17-28-51(29-18-44)88-53-32-21-46(22-33-53)77(71-73(83)65(79)42-66(80)74(71)84)61-14-8-5-11-55(61)57-36-25-48(39-63(57)77)87(50-27-38-60-59-13-7-10-16-69(59)90-70(60)41-50)49-26-37-58-56-12-6-9-15-62(56)78(64(58)40-49,72-75(85)67(81)43-68(82)76(72)86)47-23-34-54(35-24-47)89-52-30-19-45(4-2)20-31-52/h3-43H,1-2H2 |
| InChIKey | ZUCIQBOUWMLRBA-UHFFFAOYSA-N |
| XLogP | 21.77 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1196.21 |
| LogP ≤ 5 | 21.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|