C81H53F6NO2 — CID 169286506
N,N-bis[9-[4-(4-ethenylphenoxy)phenyl]-9-(2,3,6-trifluorophenyl)fluoren-2-yl]-9,9-dimethylfluoren-1-amine (PubChem CID 169286506) has the molecular formula C81H53F6NO2 and a molecular weight of 1186.31 g/mol. Its IUPAC name is N,N-bis[9-[4-(4-ethenylphenoxy)phenyl]-9-(2,3,6-trifluorophenyl)fluoren-2-yl]-9,9-dimethylfluoren-1-amine.
| Compound Name | N,N-bis[9-[4-(4-ethenylphenoxy)phenyl]-9-(2,3,6-trifluorophenyl)fluoren-2-yl]-9,9-dimethylfluoren-1-amine |
|---|---|
| PubChem CID | 169286506 |
| Molecular Formula | C81H53F6NO2 |
| Molecular Weight | 1186.31 g/mol |
| Exact Mass | 1185.40 |
| IUPAC Name | N,N-bis[9-[4-(4-ethenylphenoxy)phenyl]-9-(2,3,6-trifluorophenyl)fluoren-2-yl]-9,9-dimethylfluoren-1-amine |
| SMILES | C=Cc1ccc(Oc2ccc(C3(c4c(F)ccc(F)c4F)c4ccccc4-c4ccc(N(c5ccc6c(c5)C(c5ccc(Oc7ccc(C=C)cc7)cc5)(c5c(F)ccc(F)c5F)c5ccccc5-6)c5cccc6c5C(C)(C)c5ccccc5-6)cc43)cc2)cc1 |
| InChI | InChI=1S/C81H53F6NO2/c1-5-48-22-32-54(33-23-48)89-56-36-26-50(27-37-56)80(75-69(82)42-44-71(84)77(75)86)65-19-11-8-14-58(65)61-40-30-52(46-67(61)80)88(73-21-13-17-63-60-16-7-10-18-64(60)79(3,4)74(63)73)53-31-41-62-59-15-9-12-20-66(59)81(68(62)47-53,76-70(83)43-45-72(85)78(76)87)51-28-38-57(39-29-51)90-55-34-24-49(6-2)25-35-55/h5-47H,1-2H2,3-4H3 |
| InChIKey | CCYFRPGWIRTODP-UHFFFAOYSA-N |
| XLogP | 21.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1186.31 |
| LogP ≤ 5 | 21.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|