C54H52BN3 — CID 169287152
5,11,16-tritert-butyl-8-phenyl-20-(9-phenylcarbazol-3-yl)-1,8-diaza-20-borapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-2(7),3,5,9,11,13(21),14(19),15,17-nonaene (PubChem CID 169287152) has the molecular formula C54H52BN3 and a molecular weight of 753.84 g/mol. Its IUPAC name is 5,11,16-tritert-butyl-8-phenyl-20-(9-phenylcarbazol-3-yl)-1,8-diaza-20-borapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-2(7),3,5,9,11,13(21),14(19),15,17-nonaene.
| Compound Name | 5,11,16-tritert-butyl-8-phenyl-20-(9-phenylcarbazol-3-yl)-1,8-diaza-20-borapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-2(7),3,5,9,11,13(21),14(19),15,17-nonaene |
|---|---|
| PubChem CID | 169287152 |
| Molecular Formula | C54H52BN3 |
| Molecular Weight | 753.84 g/mol |
| Exact Mass | 753.43 |
| IUPAC Name | 5,11,16-tritert-butyl-8-phenyl-20-(9-phenylcarbazol-3-yl)-1,8-diaza-20-borapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-2(7),3,5,9,11,13(21),14(19),15,17-nonaene |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1cc(C(C)(C)C)cc3c1N(B2c1ccc2c(c1)c1ccccc1n2-c1ccccc1)c1ccc(C(C)(C)C)cc1N3c1ccccc1 |
| InChI | InChI=1S/C54H52BN3/c1-52(2,3)35-24-27-45-42(30-35)44-31-37(54(7,8)9)33-50-51(44)58(48-28-25-36(53(4,5)6)32-49(48)57(50)40-20-14-11-15-21-40)55(45)38-26-29-47-43(34-38)41-22-16-17-23-46(41)56(47)39-18-12-10-13-19-39/h10-34H,1-9H3 |
| InChIKey | LETWLZNNQQCOLE-UHFFFAOYSA-N |
| XLogP | 13.38 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.84 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|