C46H28N6O — CID 169287485
10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-isocyanophenyl]-21-phenyl-14-oxa-10,21-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaene (PubChem CID 169287485) has the molecular formula C46H28N6O and a molecular weight of 680.77 g/mol. Its IUPAC name is 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-isocyanophenyl]-21-phenyl-14-oxa-10,21-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaene.
| Compound Name | 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-isocyanophenyl]-21-phenyl-14-oxa-10,21-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 169287485 |
| Molecular Formula | C46H28N6O |
| Molecular Weight | 680.77 g/mol |
| Exact Mass | 680.23 |
| IUPAC Name | 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-isocyanophenyl]-21-phenyl-14-oxa-10,21-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaene |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)ccc1-n1c2ccccc2c2cc3c(cc21)Oc1ccccc1N3c1ccccc1 |
| InChI | InChI=1S/C46H28N6O/c1-47-36-27-32(46-49-44(30-15-5-2-6-16-30)48-45(50-46)31-17-7-3-8-18-31)25-26-38(36)52-37-22-12-11-21-34(37)35-28-41-43(29-40(35)52)53-42-24-14-13-23-39(42)51(41)33-19-9-4-10-20-33/h2-29H |
| InChIKey | YPZKZHPGTBJDMC-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 60.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.77 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|