C32H24FN6O3S — CID 169290651
CID 169290651 (PubChem CID 169290651) has the molecular formula C32H24FN6O3S and a molecular weight of 591.65 g/mol.
| Compound Name | CID 169290651 |
|---|---|
| PubChem CID | 169290651 |
| Molecular Formula | C32H24FN6O3S |
| Molecular Weight | 591.65 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | — |
| SMILES | N#Cc1ccc(COc2cccc([C]3CCN(Cc4nc5ccc(C(=O)O)cc5n4Cc4cncs4)[C]4C[C]34)n2)c(F)c1 |
| InChI | InChI=1S/C32H24FN6O3S/c33-25-10-19(13-34)4-5-21(25)17-42-31-3-1-2-26(37-31)23-8-9-38(28-12-24(23)28)16-30-36-27-7-6-20(32(40)41)11-29(27)39(30)15-22-14-35-18-43-22/h1-7,10-11,14,18H,8-9,12,15-17H2,(H,40,41) |
| InChIKey | BEPMXQVQHQEOIY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.65 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |