About [3-(hydroxymethyl)-2,4-dihydropyran-3-yl]methanol
[3-(hydroxymethyl)-2,4-dihydropyran-3-yl]methanol (PubChem CID 169291221) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is [3-(hydroxymethyl)-2,4-dihydropyran-3-yl]methanol.
Molecular Properties
| Compound Name | [3-(hydroxymethyl)-2,4-dihydropyran-3-yl]methanol |
| PubChem CID | 169291221 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | [3-(hydroxymethyl)-2,4-dihydropyran-3-yl]methanol |
| SMILES | OCC1(CO)CC=COC1 |
| InChI | InChI=1S/C7H12O3/c8-4-7(5-9)2-1-3-10-6-7/h1,3,8-9H,2,4-6H2 |
| InChIKey | MANALRFBYWJVHZ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(hydroxymethyl)-2,4-dihydropyran-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(hydroxymethyl)-2,4-dihydropyran-3-yl]methanol?
The IUPAC name of [3-(hydroxymethyl)-2,4-dihydropyran-3-yl]methanol (CID 169291221) is [3-(hydroxymethyl)-2,4-dihydropyran-3-yl]methanol.
What is the SMILES notation for [3-(hydroxymethyl)-2,4-dihydropyran-3-yl]methanol?
The canonical SMILES for [3-(hydroxymethyl)-2,4-dihydropyran-3-yl]methanol is OCC1(CO)CC=COC1.
What is the InChIKey of [3-(hydroxymethyl)-2,4-dihydropyran-3-yl]methanol?
The InChIKey is MANALRFBYWJVHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c8-4-7(5-9)2-1-3-10-6-7/h1,3,8-9H,2,4-6H2.
What are the key properties of [3-(hydroxymethyl)-2,4-dihydropyran-3-yl]methanol?
[3-(hydroxymethyl)-2,4-dihydropyran-3-yl]methanol has a molecular weight of 144.17 g/mol, XLogP of -0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(hydroxymethyl)-2,4-dihydropyran-3-yl]methanol is sourced from PubChem (CID 169291221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).