C25H30FNO5 — CID 169291953
4-[3-(cyclopentyloxymethyl)-4-(2-fluoro-3-methoxyphenyl)anilino]oxane-4-carboxylic acid (PubChem CID 169291953) has the molecular formula C25H30FNO5 and a molecular weight of 443.52 g/mol. Its IUPAC name is 4-[3-(cyclopentyloxymethyl)-4-(2-fluoro-3-methoxyphenyl)anilino]oxane-4-carboxylic acid.
| Compound Name | 4-[3-(cyclopentyloxymethyl)-4-(2-fluoro-3-methoxyphenyl)anilino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 169291953 |
| Molecular Formula | C25H30FNO5 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 4-[3-(cyclopentyloxymethyl)-4-(2-fluoro-3-methoxyphenyl)anilino]oxane-4-carboxylic acid |
| SMILES | COc1cccc(-c2ccc(NC3(C(=O)O)CCOCC3)cc2COC2CCCC2)c1F |
| InChI | InChI=1S/C25H30FNO5/c1-30-22-8-4-7-21(23(22)26)20-10-9-18(15-17(20)16-32-19-5-2-3-6-19)27-25(24(28)29)11-13-31-14-12-25/h4,7-10,15,19,27H,2-3,5-6,11-14,16H2,1H3,(H,28,29) |
| InChIKey | LQVAYTASMWYUET-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |