About 3-chloro-2,6-dimethoxypyridin-4-amine
3-chloro-2,6-dimethoxypyridin-4-amine (PubChem CID 169292016) has the molecular formula C7H9ClN2O2
and a molecular weight of 188.61 g/mol. Its IUPAC name is 3-chloro-2,6-dimethoxypyridin-4-amine.
Molecular Properties
| Compound Name | 3-chloro-2,6-dimethoxypyridin-4-amine |
| PubChem CID | 169292016 |
| Molecular Formula | C7H9ClN2O2 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 3-chloro-2,6-dimethoxypyridin-4-amine |
| SMILES | COc1cc(N)c(Cl)c(OC)n1 |
| InChI | InChI=1S/C7H9ClN2O2/c1-11-5-3-4(9)6(8)7(10-5)12-2/h3H,1-2H3,(H2,9,10) |
| InChIKey | APXZCYJMGUPSHZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-2,6-dimethoxypyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,6-dimethoxypyridin-4-amine?
The IUPAC name of 3-chloro-2,6-dimethoxypyridin-4-amine (CID 169292016) is 3-chloro-2,6-dimethoxypyridin-4-amine.
What is the SMILES notation for 3-chloro-2,6-dimethoxypyridin-4-amine?
The canonical SMILES for 3-chloro-2,6-dimethoxypyridin-4-amine is COc1cc(N)c(Cl)c(OC)n1.
What is the InChIKey of 3-chloro-2,6-dimethoxypyridin-4-amine?
The InChIKey is APXZCYJMGUPSHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O2/c1-11-5-3-4(9)6(8)7(10-5)12-2/h3H,1-2H3,(H2,9,10).
What are the key properties of 3-chloro-2,6-dimethoxypyridin-4-amine?
3-chloro-2,6-dimethoxypyridin-4-amine has a molecular weight of 188.61 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,6-dimethoxypyridin-4-amine is sourced from PubChem (CID 169292016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).