C29H44O5S — CID 169292431
[(3R,5R,8R,9R,10S,13S,14S,17S)-3-(ethoxymethyl)-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl 4-methylbenzenesulfonate (PubChem CID 169292431) has the molecular formula C29H44O5S and a molecular weight of 504.73 g/mol. Its IUPAC name is [(3R,5R,8R,9R,10S,13S,14S,17S)-3-(ethoxymethyl)-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3R,5R,8R,9R,10S,13S,14S,17S)-3-(ethoxymethyl)-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 169292431 |
| Molecular Formula | C29H44O5S |
| Molecular Weight | 504.73 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | [(3R,5R,8R,9R,10S,13S,14S,17S)-3-(ethoxymethyl)-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CCOC[C@@]1(O)CC[C@H]2[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](COS(=O)(=O)c4ccc(C)cc4)CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H44O5S/c1-4-33-19-29(30)16-14-24-21(17-29)7-11-26-25(24)13-15-28(3)22(8-12-27(26)28)18-34-35(31,32)23-9-5-20(2)6-10-23/h5-6,9-10,21-22,24-27,30H,4,7-8,11-19H2,1-3H3/t21-,22-,24+,25-,26-,27+,28-,29-/m1/s1 |
| InChIKey | UQXXFERVYKOPQT-NBCNPYCCSA-N |
| XLogP | 5.74 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.73 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|