About CID 169292618
CID 169292618 (PubChem CID 169292618) has the molecular formula C40H22B2N12O4Pt2-6
and a molecular weight of 1146.48 g/mol.
Molecular Properties
| Compound Name | CID 169292618 |
| PubChem CID | 169292618 |
| Molecular Formula | C40H22B2N12O4Pt2-6 |
| Molecular Weight | 1146.48 g/mol |
| Exact Mass | 1146.14 |
| IUPAC Name | — |
| SMILES | CN1C=CN(c2[c-]c3c(nc2)Oc2c4c5c(c6c2B3c2[c-]c(-n3cccn3)cnc2O6)Oc2ncc(-n3cccn3)[c-]c2B5c2[c-]c(N3C=CN(C)[CH-]3)cnc2O4)[CH-]1.[Pt].[Pt] |
| InChI | InChI=1S/C40H22B2N12O4.2Pt/c1-49-9-11-51(21-49)23-13-27-37(43-17-23)55-33-31-35(57-39-29(41(27)31)15-25(19-45-39)53-7-3-5-47-53)36-32-34(33)56-38-28(14-24(18-44-38)52-12-10-50(2)22-52)42(32)30-16-26(20-46-40(30)58-36)54-8-4-6-48-54;;/h3-12,17-22H,1-2H3;;/q-6;; |
| InChIKey | LUBFWMATRMCLSE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 137.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1146.48 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169292618 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169292618?
The IUPAC name of CID 169292618 (CID 169292618) is not available.
What is the SMILES notation for CID 169292618?
The canonical SMILES for CID 169292618 is CN1C=CN(c2[c-]c3c(nc2)Oc2c4c5c(c6c2B3c2[c-]c(-n3cccn3)cnc2O6)Oc2ncc(-n3cccn3)[c-]c2B5c2[c-]c(N3C=CN(C)[CH-]3)cnc2O4)[CH-]1.[Pt].[Pt].
What is the InChIKey of CID 169292618?
The InChIKey is LUBFWMATRMCLSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H22B2N12O4.2Pt/c1-49-9-11-51(21-49)23-13-27-37(43-17-23)55-33-31-35(57-39-29(41(27)31)15-25(19-45-39)53-7-3-5-47-53)36-32-34(33)56-38-28(14-24(18-44-38)52-12-10-50(2)22-52)42(32)30-16-26(20-46-40(30)58-36)54-8-4-6-48-54;;/h3-12,17-22H,1-2H3;;/q-6;;.
What are the key properties of CID 169292618?
CID 169292618 has a molecular weight of 1146.48 g/mol, XLogP of 0.97, 4 rotatable bonds, 0 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169292618 is sourced from PubChem (CID 169292618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).