C22H23FN4O5P+ — CID 169293120
[(1R,2S,3R,5R)-3-(9-benzoyl-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-3-yl)-2-fluoro-5-(hydroxymethyl)cyclopentyl]oxy-hydroxy-oxophosphanium (PubChem CID 169293120) has the molecular formula C22H23FN4O5P+ and a molecular weight of 473.42 g/mol. Its IUPAC name is [(1R,2S,3R,5R)-3-(9-benzoyl-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-3-yl)-2-fluoro-5-(hydroxymethyl)cyclopentyl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(1R,2S,3R,5R)-3-(9-benzoyl-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-3-yl)-2-fluoro-5-(hydroxymethyl)cyclopentyl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 169293120 |
| Molecular Formula | C22H23FN4O5P+ |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | [(1R,2S,3R,5R)-3-(9-benzoyl-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-3-yl)-2-fluoro-5-(hydroxymethyl)cyclopentyl]oxy-hydroxy-oxophosphanium |
| SMILES | O=C(c1ccccc1)N1CCCc2cn([C@@H]3C[C@H](CO)[C@@H](O[P+](=O)O)[C@H]3F)c3ncnc1c23 |
| InChI | InChI=1S/C22H22FN4O5P/c23-18-16(9-15(11-28)19(18)32-33(30)31)27-10-14-7-4-8-26(20-17(14)21(27)25-12-24-20)22(29)13-5-2-1-3-6-13/h1-3,5-6,10,12,15-16,18-19,28H,4,7-9,11H2/p+1/t15-,16-,18+,19-/m1/s1 |
| InChIKey | LGMPSSWLROCGOL-ZAWLATJESA-O |
| XLogP | 2.95 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|