C37H30OSi — CID 169293942
[4-[7-(4-dibenzofuran-4-ylphenyl)naphthalen-2-yl]phenyl]-trimethylsilane (PubChem CID 169293942) has the molecular formula C37H30OSi and a molecular weight of 518.73 g/mol. Its IUPAC name is [4-[7-(4-dibenzofuran-4-ylphenyl)naphthalen-2-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[7-(4-dibenzofuran-4-ylphenyl)naphthalen-2-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 169293942 |
| Molecular Formula | C37H30OSi |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | [4-[7-(4-dibenzofuran-4-ylphenyl)naphthalen-2-yl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc3ccc(-c4ccc(-c5cccc6c5oc5ccccc56)cc4)cc3c2)cc1 |
| InChI | InChI=1S/C37H30OSi/c1-39(2,3)32-21-19-26(20-22-32)30-18-14-27-13-17-29(23-31(27)24-30)25-11-15-28(16-12-25)33-8-6-9-35-34-7-4-5-10-36(34)38-37(33)35/h4-24H,1-3H3 |
| InChIKey | ZMXIBAWMZJLTNN-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|