C10H15F3O4 — CID 169294449
(3aS,4R,5S,7S,7aR)-2,2-dimethyl-7-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,5-diol (PubChem CID 169294449) has the molecular formula C10H15F3O4 and a molecular weight of 256.22 g/mol. Its IUPAC name is (3aS,4R,5S,7S,7aR)-2,2-dimethyl-7-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,5-diol.
| Compound Name | (3aS,4R,5S,7S,7aR)-2,2-dimethyl-7-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,5-diol |
|---|---|
| PubChem CID | 169294449 |
| Molecular Formula | C10H15F3O4 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (3aS,4R,5S,7S,7aR)-2,2-dimethyl-7-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,5-diol |
| SMILES | CC1(C)O[C@H]2[C@H](O)[C@@H](O)C[C@H](C(F)(F)F)[C@H]2O1 |
| InChI | InChI=1S/C10H15F3O4/c1-9(2)16-7-4(10(11,12)13)3-5(14)6(15)8(7)17-9/h4-8,14-15H,3H2,1-2H3/t4-,5-,6+,7+,8-/m0/s1 |
| InChIKey | ITBBMPRRXQUGFQ-TXXZRHAASA-N |
| XLogP | 0.81 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |