C42H28N4 — CID 169296937
4-[3-(6-naphthalen-1-ylpyrimidin-4-yl)phenyl]-2-phenyl-6-(4-phenylphenyl)pyrimidine (PubChem CID 169296937) has the molecular formula C42H28N4 and a molecular weight of 588.71 g/mol. Its IUPAC name is 4-[3-(6-naphthalen-1-ylpyrimidin-4-yl)phenyl]-2-phenyl-6-(4-phenylphenyl)pyrimidine.
| Compound Name | 4-[3-(6-naphthalen-1-ylpyrimidin-4-yl)phenyl]-2-phenyl-6-(4-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 169296937 |
| Molecular Formula | C42H28N4 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | 4-[3-(6-naphthalen-1-ylpyrimidin-4-yl)phenyl]-2-phenyl-6-(4-phenylphenyl)pyrimidine |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4cccc(-c5cc(-c6cccc7ccccc67)ncn5)c4)nc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C42H28N4/c1-3-11-29(12-4-1)30-21-23-32(24-22-30)39-27-40(46-42(45-39)33-14-5-2-6-15-33)35-18-9-17-34(25-35)38-26-41(44-28-43-38)37-20-10-16-31-13-7-8-19-36(31)37/h1-28H |
| InChIKey | KWQPJNWMDZPWRA-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |