C49H29N7O — CID 169296957
4-dibenzofuran-1-yl-2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 169296957) has the molecular formula C49H29N7O and a molecular weight of 731.82 g/mol. Its IUPAC name is 4-dibenzofuran-1-yl-2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 4-dibenzofuran-1-yl-2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 169296957 |
| Molecular Formula | C49H29N7O |
| Molecular Weight | 731.82 g/mol |
| Exact Mass | 731.24 |
| IUPAC Name | 4-dibenzofuran-1-yl-2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | N#Cc1c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc(-c2cccc3oc4ccccc4c23)cc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C49H29N7O/c50-30-40-38(48-53-44(31-16-5-1-6-17-31)51-45(54-48)32-18-7-2-8-19-32)28-35(36-25-15-27-42-43(36)37-24-13-14-26-41(37)57-42)29-39(40)49-55-46(33-20-9-3-10-21-33)52-47(56-49)34-22-11-4-12-23-34/h1-29H |
| InChIKey | NPGQRLATOJWXMX-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 114.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.82 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |