C20H29FO2 — CID 169298065
(3E,7Z)-3-fluoro-5,6-dimethylidene-9-octoxydeca-1,3,7,9-tetraen-2-ol (PubChem CID 169298065) has the molecular formula C20H29FO2 and a molecular weight of 320.45 g/mol. Its IUPAC name is (3E,7Z)-3-fluoro-5,6-dimethylidene-9-octoxydeca-1,3,7,9-tetraen-2-ol.
| Compound Name | (3E,7Z)-3-fluoro-5,6-dimethylidene-9-octoxydeca-1,3,7,9-tetraen-2-ol |
|---|---|
| PubChem CID | 169298065 |
| Molecular Formula | C20H29FO2 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (3E,7Z)-3-fluoro-5,6-dimethylidene-9-octoxydeca-1,3,7,9-tetraen-2-ol |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C(\F)C(=C)O)OCCCCCCCC |
| InChI | InChI=1S/C20H29FO2/c1-6-7-8-9-10-11-14-23-18(4)13-12-16(2)17(3)15-20(21)19(5)22/h12-13,15,22H,2-11,14H2,1H3/b13-12-,20-15+ |
| InChIKey | HSYYLNUDEVDVMA-LEXSWAQZSA-N |
| XLogP | 6.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|