C38H39Cl2N5O2 — CID 169298824
(3R)-3-chloro-10-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-methyl-2-(1-methylindol-3-yl)-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazino[1,2-a]indol-1-one (PubChem CID 169298824) has the molecular formula C38H39Cl2N5O2 and a molecular weight of 668.67 g/mol. Its IUPAC name is (3R)-3-chloro-10-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-methyl-2-(1-methylindol-3-yl)-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazino[1,2-a]indol-1-one.
| Compound Name | (3R)-3-chloro-10-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-methyl-2-(1-methylindol-3-yl)-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazino[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 169298824 |
| Molecular Formula | C38H39Cl2N5O2 |
| Molecular Weight | 668.67 g/mol |
| Exact Mass | 667.25 |
| IUPAC Name | (3R)-3-chloro-10-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-methyl-2-(1-methylindol-3-yl)-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazino[1,2-a]indol-1-one |
| SMILES | Cc1cc(OCCCc2c3n(c4c(-c5c(C)nn(C)c5C)cccc24)C(C)[C@@H](Cl)N(c2cn(C)c4ccccc24)C3=O)cc(C)c1Cl |
| InChI | InChI=1S/C38H39Cl2N5O2/c1-21-18-26(19-22(2)34(21)39)47-17-11-15-28-27-13-10-14-30(33-23(3)41-43(7)24(33)4)35(27)44-25(5)37(40)45(38(46)36(28)44)32-20-42(6)31-16-9-8-12-29(31)32/h8-10,12-14,16,18-20,25,37H,11,15,17H2,1-7H3/t25?,37-/m0/s1 |
| InChIKey | GILJUKIKSPDOGQ-KLRSRVOOSA-N |
| XLogP | 9.22 |
| TPSA | 57.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.67 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|