C20H38O7Si — CID 169299199
tert-butyl [(2R,3R,4S)-4-hydroxy-4-methyl-5-oxo-2-[tri(propan-2-yl)silyloxymethyl]oxolan-3-yl] carbonate (PubChem CID 169299199) has the molecular formula C20H38O7Si and a molecular weight of 418.60 g/mol. Its IUPAC name is tert-butyl [(2R,3R,4S)-4-hydroxy-4-methyl-5-oxo-2-[tri(propan-2-yl)silyloxymethyl]oxolan-3-yl] carbonate.
| Compound Name | tert-butyl [(2R,3R,4S)-4-hydroxy-4-methyl-5-oxo-2-[tri(propan-2-yl)silyloxymethyl]oxolan-3-yl] carbonate |
|---|---|
| PubChem CID | 169299199 |
| Molecular Formula | C20H38O7Si |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | tert-butyl [(2R,3R,4S)-4-hydroxy-4-methyl-5-oxo-2-[tri(propan-2-yl)silyloxymethyl]oxolan-3-yl] carbonate |
| SMILES | CC(C)[Si](OC[C@H]1OC(=O)[C@@](C)(O)[C@@H]1OC(=O)OC(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H38O7Si/c1-12(2)28(13(3)4,14(5)6)24-11-15-16(20(10,23)17(21)25-15)26-18(22)27-19(7,8)9/h12-16,23H,11H2,1-10H3/t15-,16-,20+/m1/s1 |
| InChIKey | OORUZJUFUXXIQM-QINHECLXSA-N |
| XLogP | 4.18 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|