About [(2R,3R,4R)-4-fluoro-4-methyl-3-oxaldehydoyloxy-5-oxooxolan-2-yl]methyl 2-oxoacetate
[(2R,3R,4R)-4-fluoro-4-methyl-3-oxaldehydoyloxy-5-oxooxolan-2-yl]methyl 2-oxoacetate (PubChem CID 169299253) has the molecular formula C10H9FO8
and a molecular weight of 276.17 g/mol. Its IUPAC name is [(2R,3R,4R)-4-fluoro-4-methyl-3-oxaldehydoyloxy-5-oxooxolan-2-yl]methyl 2-oxoacetate.
Molecular Properties
| Compound Name | [(2R,3R,4R)-4-fluoro-4-methyl-3-oxaldehydoyloxy-5-oxooxolan-2-yl]methyl 2-oxoacetate |
| PubChem CID | 169299253 |
| Molecular Formula | C10H9FO8 |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | [(2R,3R,4R)-4-fluoro-4-methyl-3-oxaldehydoyloxy-5-oxooxolan-2-yl]methyl 2-oxoacetate |
| SMILES | C[C@]1(F)C(=O)O[C@H](COC(=O)C=O)[C@H]1OC(=O)C=O |
| InChI | InChI=1S/C10H9FO8/c1-10(11)8(19-7(15)3-13)5(18-9(10)16)4-17-6(14)2-12/h2-3,5,8H,4H2,1H3/t5-,8-,10-/m1/s1 |
| InChIKey | KHAGLWMPJMZXFE-DPKJLXEKSA-N |
| XLogP | -1.51 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R,4R)-4-fluoro-4-methyl-3-oxaldehydoyloxy-5-oxooxolan-2-yl]methyl 2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R,4R)-4-fluoro-4-methyl-3-oxaldehydoyloxy-5-oxooxolan-2-yl]methyl 2-oxoacetate?
The IUPAC name of [(2R,3R,4R)-4-fluoro-4-methyl-3-oxaldehydoyloxy-5-oxooxolan-2-yl]methyl 2-oxoacetate (CID 169299253) is [(2R,3R,4R)-4-fluoro-4-methyl-3-oxaldehydoyloxy-5-oxooxolan-2-yl]methyl 2-oxoacetate.
What is the SMILES notation for [(2R,3R,4R)-4-fluoro-4-methyl-3-oxaldehydoyloxy-5-oxooxolan-2-yl]methyl 2-oxoacetate?
The canonical SMILES for [(2R,3R,4R)-4-fluoro-4-methyl-3-oxaldehydoyloxy-5-oxooxolan-2-yl]methyl 2-oxoacetate is C[C@]1(F)C(=O)O[C@H](COC(=O)C=O)[C@H]1OC(=O)C=O.
What is the InChIKey of [(2R,3R,4R)-4-fluoro-4-methyl-3-oxaldehydoyloxy-5-oxooxolan-2-yl]methyl 2-oxoacetate?
The InChIKey is KHAGLWMPJMZXFE-DPKJLXEKSA-N. The full InChI is InChI=1S/C10H9FO8/c1-10(11)8(19-7(15)3-13)5(18-9(10)16)4-17-6(14)2-12/h2-3,5,8H,4H2,1H3/t5-,8-,10-/m1/s1.
What are the key properties of [(2R,3R,4R)-4-fluoro-4-methyl-3-oxaldehydoyloxy-5-oxooxolan-2-yl]methyl 2-oxoacetate?
[(2R,3R,4R)-4-fluoro-4-methyl-3-oxaldehydoyloxy-5-oxooxolan-2-yl]methyl 2-oxoacetate has a molecular weight of 276.17 g/mol, XLogP of -1.51, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R,4R)-4-fluoro-4-methyl-3-oxaldehydoyloxy-5-oxooxolan-2-yl]methyl 2-oxoacetate is sourced from PubChem (CID 169299253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).