C17H32O7Si — CID 169299289
[(2R,3R,4S)-4-hydroxy-4-methyl-5-oxo-3-tri(propan-2-yl)silyloxyoxolan-2-yl]methyl methyl carbonate (PubChem CID 169299289) has the molecular formula C17H32O7Si and a molecular weight of 376.52 g/mol. Its IUPAC name is [(2R,3R,4S)-4-hydroxy-4-methyl-5-oxo-3-tri(propan-2-yl)silyloxyoxolan-2-yl]methyl methyl carbonate.
| Compound Name | [(2R,3R,4S)-4-hydroxy-4-methyl-5-oxo-3-tri(propan-2-yl)silyloxyoxolan-2-yl]methyl methyl carbonate |
|---|---|
| PubChem CID | 169299289 |
| Molecular Formula | C17H32O7Si |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | [(2R,3R,4S)-4-hydroxy-4-methyl-5-oxo-3-tri(propan-2-yl)silyloxyoxolan-2-yl]methyl methyl carbonate |
| SMILES | COC(=O)OC[C@H]1OC(=O)[C@@](C)(O)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H32O7Si/c1-10(2)25(11(3)4,12(5)6)24-14-13(9-22-16(19)21-8)23-15(18)17(14,7)20/h10-14,20H,9H2,1-8H3/t13-,14-,17+/m1/s1 |
| InChIKey | MBFPQEIGFXJIAA-CPUCHLNUSA-N |
| XLogP | 3.01 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|