C54H41F2IrN3O-2 — CID 169299489
2-(1-fluoro-7-phenyl-3H-dibenzofuran-3-id-4-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole;5-fluoro-2-phenylpyridine;iridium (PubChem CID 169299489) has the molecular formula C54H41F2IrN3O-2 and a molecular weight of 978.16 g/mol. Its IUPAC name is 2-(1-fluoro-7-phenyl-3H-dibenzofuran-3-id-4-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole;5-fluoro-2-phenylpyridine;iridium.
| Compound Name | 2-(1-fluoro-7-phenyl-3H-dibenzofuran-3-id-4-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole;5-fluoro-2-phenylpyridine;iridium |
|---|---|
| PubChem CID | 169299489 |
| Molecular Formula | C54H41F2IrN3O-2 |
| Molecular Weight | 978.16 g/mol |
| Exact Mass | 978.29 |
| IUPAC Name | 2-(1-fluoro-7-phenyl-3H-dibenzofuran-3-id-4-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole;5-fluoro-2-phenylpyridine;iridium |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]cc(F)c3c2oc2cc(-c4ccccc4)ccc23)nc2ccccc21.Fc1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C43H34FN2O.C11H7FN.Ir/c1-26(2)34-23-31(29-15-9-6-10-16-29)24-35(27(3)4)41(34)46-38-18-12-11-17-37(38)45-43(46)33-21-22-36(44)40-32-20-19-30(25-39(32)47-42(33)40)28-13-7-5-8-14-28;12-10-6-7-11(13-8-10)9-4-2-1-3-5-9;/h5-20,22-27H,1-4H3;1-4,6-8H;/q2*-1; |
| InChIKey | NUCMJHZGDFHBQG-UHFFFAOYSA-N |
| XLogP | 14.80 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.16 |
| LogP ≤ 5 | 14.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|