About 2-[(1R,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile
2-[(1R,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile (PubChem CID 169300285) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-[(1R,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(1R,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile |
| PubChem CID | 169300285 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-[(1R,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile |
| SMILES | N#CC[C@]1(O)CC/C=C\CCC1 |
| InChI | InChI=1S/C10H15NO/c11-9-8-10(12)6-4-2-1-3-5-7-10/h1-2,12H,3-8H2/b2-1-/t10-/m0/s1 |
| InChIKey | RRECDXKOCCKGAH-SYBPUXJVSA-N |
| XLogP | 2.15 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile?
The IUPAC name of 2-[(1R,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile (CID 169300285) is 2-[(1R,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile.
What is the SMILES notation for 2-[(1R,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile?
The canonical SMILES for 2-[(1R,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile is N#CC[C@]1(O)CC/C=C\CCC1.
What is the InChIKey of 2-[(1R,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile?
The InChIKey is RRECDXKOCCKGAH-SYBPUXJVSA-N. The full InChI is InChI=1S/C10H15NO/c11-9-8-10(12)6-4-2-1-3-5-7-10/h1-2,12H,3-8H2/b2-1-/t10-/m0/s1.
What are the key properties of 2-[(1R,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile?
2-[(1R,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile has a molecular weight of 165.24 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile is sourced from PubChem (CID 169300285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).