C27H26N5O2+ — CID 169300421
5-benzyl-N-[[4-(6-methoxy-3H-benzimidazol-1-ium-1-yl)phenyl]methyl]-1-methylpyrazole-4-carboxamide (PubChem CID 169300421) has the molecular formula C27H26N5O2+ and a molecular weight of 452.54 g/mol. Its IUPAC name is 5-benzyl-N-[[4-(6-methoxy-3H-benzimidazol-1-ium-1-yl)phenyl]methyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-benzyl-N-[[4-(6-methoxy-3H-benzimidazol-1-ium-1-yl)phenyl]methyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 169300421 |
| Molecular Formula | C27H26N5O2+ |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 5-benzyl-N-[[4-(6-methoxy-3H-benzimidazol-1-ium-1-yl)phenyl]methyl]-1-methylpyrazole-4-carboxamide |
| SMILES | COc1ccc2[nH]c[n+](-c3ccc(CNC(=O)c4cnn(C)c4Cc4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C27H25N5O2/c1-31-25(14-19-6-4-3-5-7-19)23(17-30-31)27(33)28-16-20-8-10-21(11-9-20)32-18-29-24-13-12-22(34-2)15-26(24)32/h3-13,15,17-18H,14,16H2,1-2H3,(H,28,33)/p+1 |
| InChIKey | FLMGJPAKOGELEJ-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|