C29H20FN4S+ — CID 169301073
2-(4-fluorophenyl)-5-[1-(4-isocyanophenyl)-3-methylbenzimidazol-3-ium-2-yl]-6-methyl-1,3-benzothiazole (PubChem CID 169301073) has the molecular formula C29H20FN4S+ and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-[1-(4-isocyanophenyl)-3-methylbenzimidazol-3-ium-2-yl]-6-methyl-1,3-benzothiazole.
| Compound Name | 2-(4-fluorophenyl)-5-[1-(4-isocyanophenyl)-3-methylbenzimidazol-3-ium-2-yl]-6-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 169301073 |
| Molecular Formula | C29H20FN4S+ |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 2-(4-fluorophenyl)-5-[1-(4-isocyanophenyl)-3-methylbenzimidazol-3-ium-2-yl]-6-methyl-1,3-benzothiazole |
| SMILES | [C-]#[N+]c1ccc(-n2c(-c3cc4nc(-c5ccc(F)cc5)sc4cc3C)[n+](C)c3ccccc32)cc1 |
| InChI | InChI=1S/C29H20FN4S/c1-18-16-27-24(32-28(35-27)19-8-10-20(30)11-9-19)17-23(18)29-33(3)25-6-4-5-7-26(25)34(29)22-14-12-21(31-2)13-15-22/h4-17H,1,3H3/q+1 |
| InChIKey | IKASLOPYABWDLJ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 26.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|