C16H31NO — CID 169302315
N-(1-ethoxypropan-2-yl)-4-methyl-4-prop-2-enylhept-6-en-2-amine (PubChem CID 169302315) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is N-(1-ethoxypropan-2-yl)-4-methyl-4-prop-2-enylhept-6-en-2-amine.
| Compound Name | N-(1-ethoxypropan-2-yl)-4-methyl-4-prop-2-enylhept-6-en-2-amine |
|---|---|
| PubChem CID | 169302315 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | N-(1-ethoxypropan-2-yl)-4-methyl-4-prop-2-enylhept-6-en-2-amine |
| SMILES | C=CCC(C)(CC=C)CC(C)NC(C)COCC |
| InChI | InChI=1S/C16H31NO/c1-7-10-16(6,11-8-2)12-14(4)17-15(5)13-18-9-3/h7-8,14-15,17H,1-2,9-13H2,3-6H3 |
| InChIKey | STESQPIPUUSKEJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|